EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H29NO9 |
| Net Charge | 0 |
| Average Mass | 535.549 |
| Monoisotopic Mass | 535.18423 |
| SMILES | CCC[C@@H]1C(=O)OC2c3cc(C)cc(O)c3C3=C(C(=O)c4c(O[C@H]5C[C@@H](O)[C@@H](O)[C@H](C)O5)cccc4C3=O)N21 |
| InChI | InChI=1S/C29H29NO9/c1-4-6-16-29(36)39-28-15-9-12(2)10-17(31)21(15)23-24(30(16)28)27(35)22-14(26(23)34)7-5-8-19(22)38-20-11-18(32)25(33)13(3)37-20/h5,7-10,13,16,18,20,25,28,31-33H,4,6,11H2,1-3H3/t13-,16+,18+,20-,25-,28?/m0/s1 |
| InChIKey | UISVOFCCNUPNLI-PGFCNSGNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces venezuelae ISP5230 (ncbitaxon:953739) | - | PubMed (22050382) | compound is 1.67:1(3aS:3aR) diastereomeric mixture Strain: VS1099 |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Jadomycin DNV (CHEBI:68984) has role metabolite (CHEBI:25212) |
| Jadomycin DNV (CHEBI:68984) is a isoquinolines (CHEBI:24922) |
| Citations |
|---|