EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C48H68O16 |
| Net Charge | 0 |
| Average Mass | 901.056 |
| Monoisotopic Mass | 900.45074 |
| SMILES | [H][C@]12C[C@H](OC(C)=O)[C@]3([H])[C@@](C[C@H](O)[C@]4([H])C(C)(C)[C@@H](OC(C)=O)C[C@H](O)[C@@]34C)(C1)C(=O)O[C@]1(CCC2=O)C(=O)[C@@]23C[C@H](O)[C@]4([H])C(C)(C)[C@@H](OC(C)=O)C[C@H](O)[C@@]4(C)[C@]2([H])[C@@H](OC(C)=O)C[C@@]1([H])C3 |
| InChI | InChI=1S/C48H68O16/c1-21(49)60-30-13-25-17-47(20-29(55)37-43(7,8)35(63-24(4)52)16-33(57)45(37,10)39(30)47)41(59)64-48(12-11-27(25)53)26-14-31(61-22(2)50)38-44(9)32(56)15-34(62-23(3)51)42(5,6)36(44)28(54)19-46(38,18-26)40(48)58/h25-26,28-39,54-57H,11-20H2,1-10H3/t25-,26-,28-,29-,30-,31-,32-,33-,34-,35-,36+,37+,38-,39-,44+,45+,46-,47-,48-/m0/s1 |
| InChIKey | HBLYPVGCCIWEHX-XTETYGSLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Isodon excisus (ncbitaxon:705303) | aerial part (BTO:0001658) | PubMed (22066578) | Methanolic extract of air-dried and powdered aerial parts |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Biexcisusin C, (rel)- (CHEBI:68977) has role metabolite (CHEBI:25212) |
| Biexcisusin C, (rel)- (CHEBI:68977) is a triterpenoid (CHEBI:36615) |
| Citations |
|---|