EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C37H66O8 |
| Net Charge | 0 |
| Average Mass | 638.927 |
| Monoisotopic Mass | 638.47577 |
| SMILES | [H][C@]1([C@H](O)CC[C@H](O)[C@]2([H])CC[C@@H](CCCCCCCCCC3=C[C@H](C)OC3=O)O2)CC[C@]([H])([C@@H](O)CCC[C@@H](O)CCCCCC)O1 |
| InChI | InChI=1S/C37H66O8/c1-3-4-5-12-16-29(38)17-14-19-31(39)35-24-25-36(45-35)33(41)22-21-32(40)34-23-20-30(44-34)18-13-10-8-6-7-9-11-15-28-26-27(2)43-37(28)42/h26-27,29-36,38-41H,3-25H2,1-2H3/t27-,29-,30+,31-,32-,33+,34-,35+,36+/m0/s1 |
| InChIKey | HKIHGTSLUYNNHM-LIASLPPCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Annona squamosa (ncbitaxon:301693) | seed (BTO:0001226) | PubMed (22011319) | 95% ethanolic extract of seeds |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| squamostatin-A (CHEBI:68973) has role metabolite (CHEBI:25212) |
| squamostatin-A (CHEBI:68973) is a polyketide (CHEBI:26188) |
| Synonym | Source |
|---|---|
| (5S)-3-(9-{(2R,5S)-5-[(1S,4R)-4-{(2R,5R)-5-[(1S,5S)-1,5-Dihydroxyundecyl]tetrahydro-2-furanyl}-1,4-dihydroxybutyl]tetrahydro-2-furanyl}nonyl)-5-methyl-2(5H)-furanone | ChEBI |
| Citations |
|---|