EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C37H66O8 |
| Net Charge | 0 |
| Average Mass | 638.927 |
| Monoisotopic Mass | 638.47577 |
| SMILES | [H][C@@]1([C@H](O)CC[C@H](O)[C@]2([H])CC[C@@H](CCCCCCCCCCCCCCC3=C[C@H](C)OC3=O)O2)CC[C@@]([H])([C@@H](O)[C@@H](O)CCCC)O1 |
| InChI | InChI=1S/C37H66O8/c1-3-4-19-32(40)36(41)35-25-24-34(45-35)31(39)22-21-30(38)33-23-20-29(44-33)18-16-14-12-10-8-6-5-7-9-11-13-15-17-28-26-27(2)43-37(28)42/h26-27,29-36,38-41H,3-25H2,1-2H3/t27-,29+,30-,31+,32-,33-,34-,35-,36-/m0/s1 |
| InChIKey | RWJFJCUKDFQLBE-PPRJGXARSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Annona squamosa (ncbitaxon:301693) | seed (BTO:0001226) | PubMed (22011319) | 95% ethanolic extract of seeds |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Annosquatin-I, (rel)- (CHEBI:68969) has role metabolite (CHEBI:25212) |
| Annosquatin-I, (rel)- (CHEBI:68969) is a polyketide (CHEBI:26188) |
| Citations |
|---|