EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H22O9 |
| Net Charge | 0 |
| Average Mass | 346.332 |
| Monoisotopic Mass | 346.12638 |
| SMILES | COc1cc(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)cc(OC)c1OC |
| InChI | InChI=1S/C15H22O9/c1-20-8-4-7(5-9(21-2)14(8)22-3)23-15-13(19)12(18)11(17)10(6-16)24-15/h4-5,10-13,15-19H,6H2,1-3H3/t10-,11-,12+,13-,15-/m1/s1 |
| InChIKey | NBLLRWANAFOKON-ZHZXCYKASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Acer saccharum (ncbitaxon:4024) | bark (BTO:0001301) | PubMed (22032697) | The air-dried powder of the bark was extracted by maceration with methanol |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| koaburside (CHEBI:68966) has role metabolite (CHEBI:25212) |
| koaburside (CHEBI:68966) is a glycoside (CHEBI:24400) |
| Synonym | Source |
|---|---|
| 3,4,5-trimethoxyphenyl beta-D-glucopyranoside | ChEBI |
| Citations |
|---|