EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H34O10 |
| Net Charge | 0 |
| Average Mass | 506.548 |
| Monoisotopic Mass | 506.21520 |
| SMILES | COc1cc([C@@H]2Oc3c(OC)cc(CCCO)cc3[C@H]2CO)ccc1O[C@@H]1O[C@@H](C)[C@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C26H34O10/c1-13-21(29)22(30)23(31)26(34-13)35-18-7-6-15(11-19(18)32-2)24-17(12-28)16-9-14(5-4-8-27)10-20(33-3)25(16)36-24/h6-7,9-11,13,17,21-24,26-31H,4-5,8,12H2,1-3H3/t13-,17+,21-,22+,23+,24-,26-/m0/s1 |
| InChIKey | FYWCDZKQBWSMDD-YGYBHAICSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Acer saccharum (ncbitaxon:4024) | bark (BTO:0001301) | PubMed (22032697) | The air-dried powder of the bark was extracted by maceration with methanol |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Icariside E4 (CHEBI:68965) has role metabolite (CHEBI:25212) |
| Icariside E4 (CHEBI:68965) is a benzofurans (CHEBI:35259) |
| Synonym | Source |
|---|---|
| 4-[(2R,3S)-3-(Hydroxymethyl)-5-(3-hydroxypropyl)-7-methoxy-2,3-dihydro-1-benzofuran-2-yl]-2-methoxyphenyl 6-deoxy-alpha-L-mannopyranoside | ChEBI |
| Citations |
|---|