EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H26O11 |
| Net Charge | 0 |
| Average Mass | 466.439 |
| Monoisotopic Mass | 466.14751 |
| SMILES | COc1cc(C(=O)OC[C@H]2O[C@@H](Oc3ccc(CO)cc3OC)[C@H](O)[C@@H](O)[C@@H]2O)ccc1O |
| InChI | InChI=1S/C22H26O11/c1-29-15-8-12(4-5-13(15)24)21(28)31-10-17-18(25)19(26)20(27)22(33-17)32-14-6-3-11(9-23)7-16(14)30-2/h3-8,17-20,22-27H,9-10H2,1-2H3/t17-,18-,19+,20-,22-/m1/s1 |
| InChIKey | XDCJBRVCYFCQAN-OUUKCGNVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Acer saccharum (ncbitaxon:4024) | bark (BTO:0001301) | PubMed (22032697) | The air-dried powder of the bark was extracted by maceration with methanol |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Saccharumoside B (CHEBI:68960) has role metabolite (CHEBI:25212) |
| Saccharumoside B (CHEBI:68960) is a tannin (CHEBI:26848) |
| Synonym | Source |
|---|---|
| 4-O-(6-vanilloyl)-beta-D-glucopyranosyl vanillyl alcohol | ChEBI |
| Citations |
|---|