EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H40O14 |
| Net Charge | 0 |
| Average Mass | 672.680 |
| Monoisotopic Mass | 672.24181 |
| SMILES | COc1cc(C(=O)OC[C@H]2O[C@@H](Oc3ccc([C@@H]4Oc5c(OC)cc(CCCO)cc5[C@H]4CO)cc3OC)[C@H](O)[C@@H](O)[C@@H]2O)ccc1O |
| InChI | InChI=1S/C34H40O14/c1-42-24-14-19(6-8-22(24)37)33(41)45-16-27-28(38)29(39)30(40)34(47-27)46-23-9-7-18(13-25(23)43-2)31-21(15-36)20-11-17(5-4-10-35)12-26(44-3)32(20)48-31/h6-9,11-14,21,27-31,34-40H,4-5,10,15-16H2,1-3H3/t21-,27-,28-,29+,30-,31+,34-/m1/s1 |
| InChIKey | VGTBWTHKJXOATF-DIGBNQJTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Acer saccharum (ncbitaxon:4024) | bark (BTO:0001301) | PubMed (22032697) | The air-dried powder of the bark was extracted by maceration with methanol |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Saccharumoside A (CHEBI:68959) has role metabolite (CHEBI:25212) |
| Saccharumoside A (CHEBI:68959) is a tannin (CHEBI:26848) |
| Synonym | Source |
|---|---|
| (7R,8S)-4-O-(6-vanilloyl)-beta-D-glucopyranosyldihydrodehydroconiferyl alcohol | ChEBI |
| Citations |
|---|