EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H40O11 |
| Net Charge | 0 |
| Average Mass | 540.606 |
| Monoisotopic Mass | 540.25706 |
| SMILES | [H][C@]12O[C@]([H])(C[C@](C)(O)[C@@H](OC=O)CC[C@@]1(C)OC(C)=O)[C@]1([H])[C@@]2([H])[C@@H](C(C)C)[C@H](OC(C)=O)[C@H](OC(C)=O)[C@@]12CO2 |
| InChI | InChI=1S/C27H40O11/c1-13(2)19-20-21(27(11-34-27)24(36-15(4)30)22(19)35-14(3)29)17-10-25(6,32)18(33-12-28)8-9-26(7,23(20)37-17)38-16(5)31/h12-13,17-24,32H,8-11H2,1-7H3/t17-,18+,19-,20-,21-,22+,23-,24+,25+,26-,27-/m1/s1 |
| InChIKey | PJSHPOHLUBKHTG-ADWFZQLOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Klyxum molle (WORMS:290254) | - | PubMed (22004052) | Ethyl acetate extract of minced frozen bodies |
| Roles Classification |
|---|
| Biological Role: | coral metabolite Any animal metabolite produced during a metabolic reaction in corals (marine invertebrates). |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| klymollin H (CHEBI:68958) has role anti-inflammatory agent (CHEBI:67079) |
| klymollin H (CHEBI:68958) has role coral metabolite (CHEBI:76498) |
| klymollin H (CHEBI:68958) is a acetate ester (CHEBI:47622) |
| klymollin H (CHEBI:68958) is a epoxide (CHEBI:32955) |
| klymollin H (CHEBI:68958) is a eunicellin diterpenoid (CHEBI:76257) |
| klymollin H (CHEBI:68958) is a formate ester (CHEBI:52343) |
| klymollin H (CHEBI:68958) is a macrocycle (CHEBI:51026) |
| klymollin H (CHEBI:68958) is a oxacycle (CHEBI:38104) |
| IUPAC Name |
|---|
| (1S,2S,3S,4R,4aR,5R,6R,9S,10S,12R,12aS)-9-(formyloxy)-10-hydroxy-6,10-dimethyl-4-(propan-2-yl)dodecahydro-2H-spiro[5,12-epoxybenzo[10]annulene-1,2'-oxirane]-2,3,6-triyl triacetate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22123643 | Reaxys |
| Citations |
|---|