EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H42O11 |
| Net Charge | 0 |
| Average Mass | 554.633 |
| Monoisotopic Mass | 554.27271 |
| SMILES | [H][C@]12O[C@]([H])(C[C@](C)(O)[C@@H](OC(C)=O)CC[C@@]1(C)OC(C)=O)[C@]1([H])[C@@]2([H])[C@@H](C(C)C)[C@H](OC(C)=O)[C@H](OC(C)=O)[C@@]12CO2 |
| InChI | InChI=1S/C28H42O11/c1-13(2)20-21-22(28(12-34-28)25(37-16(5)31)23(20)36-15(4)30)18-11-26(7,33)19(35-14(3)29)9-10-27(8,24(21)38-18)39-17(6)32/h13,18-25,33H,9-12H2,1-8H3/t18-,19+,20-,21-,22-,23+,24-,25+,26+,27-,28-/m1/s1 |
| InChIKey | TUKIGDZBWGNFBT-SEQDWNMISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Klyxum molle (WORMS:290254) | - | PubMed (22004052) | Ethyl acetate extract of minced frozen bodies |
| Roles Classification |
|---|
| Biological Role: | coral metabolite Any animal metabolite produced during a metabolic reaction in corals (marine invertebrates). |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| klymollin E (CHEBI:68955) has role anti-inflammatory agent (CHEBI:67079) |
| klymollin E (CHEBI:68955) has role coral metabolite (CHEBI:76498) |
| klymollin E (CHEBI:68955) is a acetate ester (CHEBI:47622) |
| klymollin E (CHEBI:68955) is a epoxide (CHEBI:32955) |
| klymollin E (CHEBI:68955) is a eunicellin diterpenoid (CHEBI:76257) |
| klymollin E (CHEBI:68955) is a macrocycle (CHEBI:51026) |
| klymollin E (CHEBI:68955) is a oxacycle (CHEBI:38104) |
| IUPAC Name |
|---|
| rel-(1S,2S,3S,4R,4aR,5R,6R,9S,10S,12R,12aS)-10-hydroxy-6,10-dimethyl-4-(propan-2-yl)dodecahydro-2H-spiro[5,12-epoxybenzo[10]annulene-1,2'-oxirane]-2,3,6,9-tetrayl tetraacetate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22123644 | Reaxys |
| Citations |
|---|