EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H36O7 |
| Net Charge | 0 |
| Average Mass | 436.545 |
| Monoisotopic Mass | 436.24610 |
| SMILES | [H][C@]12O[C@]([H])(CC(=C)[C@@H](O)CC[C@@]1(C)OC(C)=O)[C@]1([H])[C@@]2([H])[C@@H](C(C)C)C[C@H](OC(C)=O)[C@@]12CO2 |
| InChI | InChI=1S/C24H36O7/c1-12(2)16-10-19(29-14(4)25)24(11-28-24)21-18-9-13(3)17(27)7-8-23(6,31-15(5)26)22(30-18)20(16)21/h12,16-22,27H,3,7-11H2,1-2,4-6H3/t16-,17+,18-,19+,20-,21-,22-,23-,24+/m1/s1 |
| InChIKey | MRLKNBMAHKIZKS-PWLVGILOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Klyxum molle (WORMS:290254) | - | PubMed (22004052) | Ethyl acetate extract of minced frozen bodies |
| Roles Classification |
|---|
| Biological Role: | coral metabolite Any animal metabolite produced during a metabolic reaction in corals (marine invertebrates). |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| klymollin D (CHEBI:68954) has role anti-inflammatory agent (CHEBI:67079) |
| klymollin D (CHEBI:68954) has role coral metabolite (CHEBI:76498) |
| klymollin D (CHEBI:68954) is a acetate ester (CHEBI:47622) |
| klymollin D (CHEBI:68954) is a epoxide (CHEBI:32955) |
| klymollin D (CHEBI:68954) is a eunicellin diterpenoid (CHEBI:76257) |
| klymollin D (CHEBI:68954) is a macrocycle (CHEBI:51026) |
| klymollin D (CHEBI:68954) is a oxacycle (CHEBI:38104) |
| IUPAC Name |
|---|
| rel-(1S,2S,4R,4aR,5R,6R,9S,12R,12aS)-9-hydroxy-6-methyl-10-methylidene-4-(propan-2-yl)dodecahydro-2H-spiro[5,12-epoxybenzo[10]annulene-1,2'-oxirane]-2,6-diyl diacetate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22123639 | Reaxys |
| Citations |
|---|