EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H38O9 |
| Net Charge | 0 |
| Average Mass | 494.581 |
| Monoisotopic Mass | 494.25158 |
| SMILES | [H][C@]12O[C@]([H])(CC(=C)[C@@H](O)CC[C@@]1(C)OC(C)=O)[C@]1([H])[C@@]2([H])[C@@H](C(C)C)[C@H](OC(C)=O)[C@H](OC(C)=O)[C@@]12CO2 |
| InChI | InChI=1S/C26H38O9/c1-12(2)19-20-21(26(11-31-26)24(33-15(5)28)22(19)32-14(4)27)18-10-13(3)17(30)8-9-25(7,23(20)34-18)35-16(6)29/h12,17-24,30H,3,8-11H2,1-2,4-7H3/t17-,18+,19+,20+,21+,22-,23+,24-,25+,26+/m0/s1 |
| InChIKey | IJXBJCLCYUSOPN-YRLDIHFHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Klyxum molle (WORMS:290254) | - | PubMed (22004052) | Ethyl acetate extract of minced frozen bodies |
| Roles Classification |
|---|
| Biological Role: | coral metabolite Any animal metabolite produced during a metabolic reaction in corals (marine invertebrates). |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| klymollin C (CHEBI:68953) has role anti-inflammatory agent (CHEBI:67079) |
| klymollin C (CHEBI:68953) has role coral metabolite (CHEBI:76498) |
| klymollin C (CHEBI:68953) is a acetate ester (CHEBI:47622) |
| klymollin C (CHEBI:68953) is a epoxide (CHEBI:32955) |
| klymollin C (CHEBI:68953) is a eunicellin diterpenoid (CHEBI:76257) |
| klymollin C (CHEBI:68953) is a macrocycle (CHEBI:51026) |
| klymollin C (CHEBI:68953) is a oxacycle (CHEBI:38104) |
| IUPAC Name |
|---|
| rel-(1S,2S,3S,4R,4aR,5R,6R,9S,12R,12aS)-9-hydroxy-6-methyl-10-methylidene-4-(propan-2-yl)dodecahydro-2H-spiro[5,12-epoxybenzo[10]annulene-1,2'-oxirane]-2,3,6-triyl triacetate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22123640 | Reaxys |
| Citations |
|---|