EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H16O3 |
| Net Charge | 0 |
| Average Mass | 172.224 |
| Monoisotopic Mass | 172.10994 |
| SMILES | CCCCC[C@@H](O)/C=C\C(=O)O |
| InChI | InChI=1S/C9H16O3/c1-2-3-4-5-8(10)6-7-9(11)12/h6-8,10H,2-5H2,1H3,(H,11,12)/b7-6-/t8-/m1/s1 |
| InChIKey | RLNIWODKAMVILO-NFXKFNAJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Carthamus oxyacantha (ncbitaxon:122010) | aerial part (BTO:0001658) | PubMed (22060189) | Crude ethanolic extract of aerial parts |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2Z,4R)-hydroxynon-2-enoic acid (CHEBI:68949) has role metabolite (CHEBI:25212) |
| (2Z,4R)-hydroxynon-2-enoic acid (CHEBI:68949) is a carbonyl compound (CHEBI:36586) |
| Citations |
|---|