EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H30O3 |
| Net Charge | 0 |
| Average Mass | 294.435 |
| Monoisotopic Mass | 294.21949 |
| SMILES | CCCCCC(=O)/C=C/C=C\CCCCCCCC(=O)O |
| InChI | InChI=1S/C18H30O3/c1-2-3-11-14-17(19)15-12-9-7-5-4-6-8-10-13-16-18(20)21/h7,9,12,15H,2-6,8,10-11,13-14,16H2,1H3,(H,20,21)/b9-7-,15-12+ |
| InChIKey | JHXAZBBVQSRKJR-BSZOFBHHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Carthamus oxyacantha (ncbitaxon:122010) | aerial part (BTO:0001658) | PubMed (22060189) | Crude ethanolic extract of aerial parts |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 13-oxo-9Z,11E-ODE (CHEBI:68947) has functional parent 13-HODE (CHEBI:72639) |
| 13-oxo-9Z,11E-ODE (CHEBI:68947) has role metabolite (CHEBI:25212) |
| 13-oxo-9Z,11E-ODE (CHEBI:68947) has role mouse metabolite (CHEBI:75771) |
| 13-oxo-9Z,11E-ODE (CHEBI:68947) is a 13-oxo-9,11-octadecadienoic acid (CHEBI:136531) |
| 13-oxo-9Z,11E-ODE (CHEBI:68947) is conjugate acid of 13-oxo-9Z,11E-ODE(1−) (CHEBI:90781) |
| Incoming Relation(s) |
| 13-oxo-9Z,11E-ODE(1−) (CHEBI:90781) is conjugate base of 13-oxo-9Z,11E-ODE (CHEBI:68947) |
| IUPAC Name |
|---|
| (9Z,11E)-13-oxooctadeca-9,11-dienoic acid |
| Synonyms | Source |
|---|---|
| 13-keto-9Z,11E-octadecadienoic acid | LIPID MAPS |
| 13-ketoODE | ChEBI |
| 13-KODE | KEGG COMPOUND |
| 13-oxoODE | ChEBI |
| 13-Oxo-ODE | LIPID MAPS |
| 13-OxoODE | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C14765 | KEGG COMPOUND |
| HMDB0004668 | HMDB |
| LMFA02000016 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5337674 | Reaxys |
| CAS:54739-30-9 | ChemIDplus |