EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H30O3 |
| Net Charge | 0 |
| Average Mass | 294.435 |
| Monoisotopic Mass | 294.21949 |
| SMILES | CCCCCC(=O)/C=C/C=C\CCCCCCCC(=O)O |
| InChI | InChI=1S/C18H30O3/c1-2-3-11-14-17(19)15-12-9-7-5-4-6-8-10-13-16-18(20)21/h7,9,12,15H,2-6,8,10-11,13-14,16H2,1H3,(H,20,21)/b9-7-,15-12+ |
| InChIKey | JHXAZBBVQSRKJR-BSZOFBHHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Carthamus oxyacantha (ncbitaxon:122010) | aerial part (BTO:0001658) | PubMed (22060189) | Crude ethanolic extract of aerial parts |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 13-oxo-9Z,11E-ODE (CHEBI:68947) has functional parent 13-HODE (CHEBI:72639) |
| 13-oxo-9Z,11E-ODE (CHEBI:68947) has role metabolite (CHEBI:25212) |
| 13-oxo-9Z,11E-ODE (CHEBI:68947) has role mouse metabolite (CHEBI:75771) |
| 13-oxo-9Z,11E-ODE (CHEBI:68947) is a 13-oxo-9,11-octadecadienoic acid (CHEBI:136531) |
| 13-oxo-9Z,11E-ODE (CHEBI:68947) is conjugate acid of 13-oxo-9Z,11E-ODE(1−) (CHEBI:90781) |
| Incoming Relation(s) |
| 13-oxo-9Z,11E-ODE(1−) (CHEBI:90781) is conjugate base of 13-oxo-9Z,11E-ODE (CHEBI:68947) |
| IUPAC Name |
|---|
| (9Z,11E)-13-oxooctadeca-9,11-dienoic acid |
| Synonyms | Source |
|---|---|
| 13-OxoODE | KEGG COMPOUND |
| 13-KODE | KEGG COMPOUND |
| 13-keto-9Z,11E-octadecadienoic acid | LIPID MAPS |
| 13-Oxo-ODE | LIPID MAPS |
| 13-ketoODE | ChEBI |
| 13-oxoODE | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C14765 | KEGG COMPOUND |
| HMDB0004668 | HMDB |
| LMFA02000016 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5337674 | Reaxys |
| CAS:54739-30-9 | ChemIDplus |