EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H36O7 |
| Net Charge | 0 |
| Average Mass | 400.512 |
| Monoisotopic Mass | 400.24610 |
| SMILES | C=C1[C@H](OO)CC[C@H](C)[C@@]12CC[C@@H](C(C)(C)O[C@@H]1O[C@H](C)[C@H](O)[C@H](O)[C@H]1O)C2 |
| InChI | InChI=1S/C21H36O7/c1-11-6-7-15(28-25)12(2)21(11)9-8-14(10-21)20(4,5)27-19-18(24)17(23)16(22)13(3)26-19/h11,13-19,22-25H,2,6-10H2,1,3-5H3/t11-,13+,14+,15+,16-,17-,18+,19-,21-/m0/s1 |
| InChIKey | WXLVRXBQCVFTIV-MBAINBPKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Carthamus oxyacantha (ncbitaxon:122010) | aerial part (BTO:0001658) | PubMed (22060189) | Crude ethanolic extract of aerial parts |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rel-(2R,5S,7R,10S)-7-Hydroperoxy-2-[(1-methyl-1-beta-D-fucopyranosyloxy)ethyl]-10-methyl-6-methylenespiro[4.5]-decane (CHEBI:68944) has role metabolite (CHEBI:25212) |
| rel-(2R,5S,7R,10S)-7-Hydroperoxy-2-[(1-methyl-1-beta-D-fucopyranosyloxy)ethyl]-10-methyl-6-methylenespiro[4.5]-decane (CHEBI:68944) is a terpene glycoside (CHEBI:61777) |
| Citations |
|---|