EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H34O12 |
| Net Charge | 0 |
| Average Mass | 550.557 |
| Monoisotopic Mass | 550.20503 |
| SMILES | COc1ccc(C[C@H]2COC(=O)[C@]2(O)Cc2ccc(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c(OC)c2)cc1OC |
| InChI | InChI=1S/C27H34O12/c1-34-17-6-4-14(9-19(17)35-2)8-16-13-37-26(32)27(16,33)11-15-5-7-18(20(10-15)36-3)38-25-24(31)23(30)22(29)21(12-28)39-25/h4-7,9-10,16,21-25,28-31,33H,8,11-13H2,1-3H3/t16-,21+,22+,23-,24+,25+,27-/m0/s1 |
| InChIKey | LWYAMIUSVGPFKS-CGLYQLBNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Carthamus oxyacantha (ncbitaxon:122010) | aerial part (BTO:0001658) | PubMed (22060189) | Crude ethanolic extract of aerial parts |
| Carthamus tinctorius (ncbitaxon:4222) | - | PubMed (22060189) | |
| Trachelospermum (ncbitaxon:69388) | - | PubMed (22060189) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Tracheloside (CHEBI:68939) has role metabolite (CHEBI:25212) |
| Tracheloside (CHEBI:68939) is a glycoside (CHEBI:24400) |
| Tracheloside (CHEBI:68939) is a lignan (CHEBI:25036) |
| Synonym | Source |
|---|---|
| 2(3H)-Furanone, 4-((3,4-dimethoxyphenyl)methyl)-3-((4-(beta-D-glucopyranosyloxy)-3-methoxyphenyl)methyl)dihydro-3-hydroxy-, (3S-cis)- | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:33464-71-0 | ChemIDplus |
| Citations |
|---|