EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C41H40O8 |
| Net Charge | 0 |
| Average Mass | 660.763 |
| Monoisotopic Mass | 660.27232 |
| SMILES | O=C(O)CCCC(/C=C/c1ccccc1)c1c(O)c2c(c(C(/C=C/c3ccccc3)CCCC(=O)O)c1O)OC(c1ccccc1)CC2=O |
| InChI | InChI=1S/C41H40O8/c42-32-26-33(29-16-8-3-9-17-29)49-41-37(31(19-11-21-35(45)46)25-23-28-14-6-2-7-15-28)39(47)36(40(48)38(32)41)30(18-10-20-34(43)44)24-22-27-12-4-1-5-13-27/h1-9,12-17,22-25,30-31,33,47-48H,10-11,18-21,26H2,(H,43,44)(H,45,46)/b24-22+,25-23+ |
| InChIKey | VDGBAYIBHQEDHS-BQASJOSNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cryptocarya chartacea (IPNI:895985-1) | trunk bark (BTO:0001494) | PubMed (22050318) | Ethyl acetate extract of air-dried and powdered trunk bark |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. antiviral agent A substance that destroys or inhibits replication of viruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (±)-chartaceone F (CHEBI:68938) has role antiviral agent (CHEBI:22587) |
| (±)-chartaceone F (CHEBI:68938) has role plant metabolite (CHEBI:76924) |
| (±)-chartaceone F (CHEBI:68938) is a dicarboxylic acid (CHEBI:35692) |
| (±)-chartaceone F (CHEBI:68938) is a dihydroxyflavanone (CHEBI:38749) |
| IUPAC Name |
|---|
| (6E,6'E)-5,5'-(5,7-dihydroxy-4-oxo-2-phenyl-3,4-dihydro-2H-chromene-6,8-diyl)bis(7-phenylhept-6-enoic acid) |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22123630 | Reaxys |
| Citations |
|---|