EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C41H40O8 |
| Net Charge | 0 |
| Average Mass | 660.763 |
| Monoisotopic Mass | 660.27232 |
| SMILES | O=C(O)CCC/C=C/C(c1ccccc1)c1c(O)c2c(c(C(/C=C/c3ccccc3)CCCC(=O)O)c1O)OC(c1ccccc1)CC2=O |
| InChI | InChI=1S/C41H40O8/c42-32-26-33(29-18-9-3-10-19-29)49-41-36(30(20-13-23-35(45)46)25-24-27-14-5-1-6-15-27)39(47)37(40(48)38(32)41)31(28-16-7-2-8-17-28)21-11-4-12-22-34(43)44/h1-3,5-11,14-19,21,24-25,30-31,33,47-48H,4,12-13,20,22-23,26H2,(H,43,44)(H,45,46)/b21-11+,25-24+ |
| InChIKey | RAGZNEMPFYNJSA-KQFLDCGVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cryptocarya chartacea (IPNI:895985-1) | trunk bark (BTO:0001494) | PubMed (22050318) | Ethyl acetate extract of air-dried and powdered trunk bark |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antiviral agent A substance that destroys or inhibits replication of viruses. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (±)-chartaceone D (CHEBI:68936) has role antiviral agent (CHEBI:22587) |
| (±)-chartaceone D (CHEBI:68936) has role plant metabolite (CHEBI:76924) |
| (±)-chartaceone D (CHEBI:68936) is a dicarboxylic acid (CHEBI:35692) |
| (±)-chartaceone D (CHEBI:68936) is a dihydroxyflavanone (CHEBI:38749) |
| IUPAC Name |
|---|
| (5E)-7-{8-[(1E)-6-carboxy-1-phenylhex-1-en-3-yl]-5,7-dihydroxy-4-oxo-2-phenyl-3,4-dihydro-2H-chromen-6-yl}-7-phenylhept-5-enoic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22123628 | Reaxys |
| Citations |
|---|