EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H26O6 |
| Net Charge | 0 |
| Average Mass | 458.510 |
| Monoisotopic Mass | 458.17294 |
| SMILES | O=C(O)CCC/C=C/C(c1ccccc1)c1c(O)cc2c(c1O)C(=O)CC(c1ccccc1)O2 |
| InChI | InChI=1S/C28H26O6/c29-21-17-24-27(22(30)16-23(34-24)19-12-6-2-7-13-19)28(33)26(21)20(18-10-4-1-5-11-18)14-8-3-9-15-25(31)32/h1-2,4-8,10-14,17,20,23,29,33H,3,9,15-16H2,(H,31,32)/b14-8+ |
| InChIKey | JHLIRXZGNHHBHX-RIYZIHGNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cryptocarya chartacea (IPNI:895985-1) | trunk bark (BTO:0001494) | PubMed (22050318) | Ethyl acetate extract of air-dried and powdered trunk bark |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (±)-chartaceone B (CHEBI:68934) has role plant metabolite (CHEBI:76924) |
| (±)-chartaceone B (CHEBI:68934) is a dihydroxyflavanone (CHEBI:38749) |
| (±)-chartaceone B (CHEBI:68934) is a monocarboxylic acid (CHEBI:25384) |
| IUPAC Name |
|---|
| rac-(5E)-7-(5,7-dihydroxy-4-oxo-2-phenyl-3,4-dihydro-2H-chromen-6-yl)-7-phenylhept-5-enoic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22123620 | Reaxys |
| Citations |
|---|