EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H26O6 |
| Net Charge | 0 |
| Average Mass | 458.510 |
| Monoisotopic Mass | 458.17294 |
| SMILES | O=C(O)CCCC(/C=C/c1ccccc1)c1c(O)cc2c(c1O)C(=O)CC(c1ccccc1)O2 |
| InChI | InChI=1S/C28H26O6/c29-21-17-24-27(22(30)16-23(34-24)19-10-5-2-6-11-19)28(33)26(21)20(12-7-13-25(31)32)15-14-18-8-3-1-4-9-18/h1-6,8-11,14-15,17,20,23,29,33H,7,12-13,16H2,(H,31,32)/b15-14+ |
| InChIKey | SBOVSSLXUHHHLZ-CCEZHUSRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cryptocarya chartacea (IPNI:895985-1) | trunk bark (BTO:0001494) | PubMed (22050318) | Ethyl acetate extract of air-dried and powdered trunk bark |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (±)-chartaceone A (CHEBI:68933) has part chartaceone A1 (CHEBI:76573) |
| (±)-chartaceone A (CHEBI:68933) has part chartaceone A2 (CHEBI:76574) |
| (±)-chartaceone A (CHEBI:68933) has part chartaceone A3 (CHEBI:76588) |
| (±)-chartaceone A (CHEBI:68933) has part chartaceone A4 (CHEBI:76589) |
| (±)-chartaceone A (CHEBI:68933) has role plant metabolite (CHEBI:76924) |
| (±)-chartaceone A (CHEBI:68933) is a racemate (CHEBI:60911) |
| IUPAC Name |
|---|
| rac-(6E)-5-(5,7-dihydroxy-4-oxo-2-phenyl-3,4-dihydro-2H-chromen-6-yl)-7-phenylhept-6-enoic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22123619 | Reaxys |
| Citations |
|---|