EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H26O11 |
| Net Charge | 0 |
| Average Mass | 442.417 |
| Monoisotopic Mass | 442.14751 |
| SMILES | [H][C@]12[C@@H](O)[C@H](O)[C@@]3(CO)OC[C@]14[C@@]3(O)[C@@H](O)C(=O)O[C@]4([H])[C@H](O)[C@@]1([H])C(C)=CC(=O)[C@@H](O)[C@]21C |
| InChI | InChI=1S/C20H26O11/c1-6-3-7(22)12(25)17(2)8(6)9(23)15-18-5-30-19(4-21,13(26)10(24)11(17)18)20(18,29)14(27)16(28)31-15/h3,8-15,21,23-27,29H,4-5H2,1-2H3/t8-,9-,10-,11-,12-,13+,14+,15-,17+,18+,19-,20+/m1/s1 |
| InChIKey | QPBBQXZJTIVCTO-VWXLKGNHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Brucea mollis (ncbitaxon:43723) | stem (BTO:0001300) | PubMed (22070654) | Ethanolic extract of air-dried and powdered stems |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| yadanziolide B (CHEBI:68932) has parent hydride picrasane (CHEBI:36506) |
| yadanziolide B (CHEBI:68932) has role antineoplastic agent (CHEBI:35610) |
| yadanziolide B (CHEBI:68932) has role plant metabolite (CHEBI:76924) |
| yadanziolide B (CHEBI:68932) is a enone (CHEBI:51689) |
| yadanziolide B (CHEBI:68932) is a heptol (CHEBI:62610) |
| yadanziolide B (CHEBI:68932) is a organic heteropentacyclic compound (CHEBI:38164) |
| yadanziolide B (CHEBI:68932) is a quassinoid (CHEBI:72485) |
| yadanziolide B (CHEBI:68932) is a secondary α-hydroxy ketone (CHEBI:2468) |
| yadanziolide B (CHEBI:68932) is a δ-lactone (CHEBI:18946) |
| IUPAC Name |
|---|
| (1β,6α,11β,12α,15β)-1,6,11,12,14,15,21-heptahydroxy-13,20-epoxypicras-3-ene-2,16-dione |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5664336 | Reaxys |
| Citations |
|---|