EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H26O9 |
| Net Charge | 0 |
| Average Mass | 410.419 |
| Monoisotopic Mass | 410.15768 |
| SMILES | [H][C@]12[C@@H](O)[C@H](O)[C@@]3(C)OC[C@]14[C@@]3(O)[C@@H](O)C(=O)O[C@]4([H])C[C@@]1([H])C(C)=CC(=O)[C@@H](O)[C@]21C |
| InChI | InChI=1S/C20H26O9/c1-7-4-9(21)13(23)17(2)8(7)5-10-19-6-28-18(3,14(24)11(22)12(17)19)20(19,27)15(25)16(26)29-10/h4,8,10-15,22-25,27H,5-6H2,1-3H3/t8-,10+,11+,12+,13+,14-,15-,17-,18+,19+,20+/m0/s1 |
| InChIKey | JBDMZGKDLMGOFR-KQSRGDCESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Brucea mollis (ncbitaxon:43723) | stem (BTO:0001300) | PubMed (22070654) | Ethanolic extract of air-dried and powdered stems |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bruceine D (CHEBI:68931) has parent hydride picrasane (CHEBI:36506) |
| bruceine D (CHEBI:68931) has role antineoplastic agent (CHEBI:35610) |
| bruceine D (CHEBI:68931) has role metabolite (CHEBI:25212) |
| bruceine D (CHEBI:68931) has role plant metabolite (CHEBI:76924) |
| bruceine D (CHEBI:68931) is a organic heteropentacyclic compound (CHEBI:38164) |
| bruceine D (CHEBI:68931) is a pentol (CHEBI:37205) |
| bruceine D (CHEBI:68931) is a quassinoid (CHEBI:72485) |
| bruceine D (CHEBI:68931) is a secondary α-hydroxy ketone (CHEBI:2468) |
| bruceine D (CHEBI:68931) is a δ-lactone (CHEBI:18946) |
| IUPAC Name |
|---|
| (1β,11β,12α,15β)-1,11,12,14,15-pentahydroxy-13,20-epoxypicras-3-ene-2,16-dione |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9674394 | Reaxys |
| CAS:21499-66-1 | KEGG COMPOUND |
| CAS:21499-66-1 | ChemIDplus |
| Citations |
|---|