EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H38O13 |
| Net Charge | 0 |
| Average Mass | 558.577 |
| Monoisotopic Mass | 558.23124 |
| SMILES | [H][C@]12[C@@H](O)C(=O)O[C@]3([H])C[C@@]4([H])C(C)=CC(=O)[C@@H](O)[C@]4(C)[C@@]([H])([C@@H](O)[C@H](O)[C@@H]1CO[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)[C@]23C |
| InChI | InChI=1S/C26H38O13/c1-8-4-11(28)22(35)25(2)10(8)5-13-26(3)14(17(31)23(36)39-13)9(15(29)19(33)21(25)26)7-37-24-20(34)18(32)16(30)12(6-27)38-24/h4,9-10,12-22,24,27,29-35H,5-7H2,1-3H3/t9-,10+,12-,13-,14-,15-,16-,17-,18+,19+,20-,21-,22-,24-,25+,26+/m1/s1 |
| InChIKey | KVWPYBHSCXLTPN-VYEXMLHNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Brucea mollis (ncbitaxon:43723) | stem (BTO:0001300) | PubMed (22070654) | Ethanolic extract of air-dried and powdered stems |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| yadanziolide U (CHEBI:68929) has parent hydride picrasane (CHEBI:36506) |
| yadanziolide U (CHEBI:68929) has role metabolite (CHEBI:25212) |
| yadanziolide U (CHEBI:68929) has role plant metabolite (CHEBI:76924) |
| yadanziolide U (CHEBI:68929) is a enone (CHEBI:51689) |
| yadanziolide U (CHEBI:68929) is a monosaccharide derivative (CHEBI:63367) |
| yadanziolide U (CHEBI:68929) is a organic heterotetracyclic compound (CHEBI:38163) |
| yadanziolide U (CHEBI:68929) is a quassinoid (CHEBI:72485) |
| yadanziolide U (CHEBI:68929) is a secondary α-hydroxy ketone (CHEBI:2468) |
| yadanziolide U (CHEBI:68929) is a terpene glycoside (CHEBI:61777) |
| yadanziolide U (CHEBI:68929) is a tetrol (CHEBI:33573) |
| yadanziolide U (CHEBI:68929) is a β-D-glucoside (CHEBI:22798) |
| yadanziolide U (CHEBI:68929) is a δ-lactone (CHEBI:18946) |
| IUPAC Name |
|---|
| (1β,11β,12α,15β)-1,11,12,15-tetrahydroxy-2,16-dioxopicras-3-en-21-yl β-D-glucopyranoside |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22123618 | Reaxys |
| Citations |
|---|