EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H28O8 |
| Net Charge | 0 |
| Average Mass | 396.436 |
| Monoisotopic Mass | 396.17842 |
| SMILES | [H][C@]12[C@@H](O)C(=O)O[C@]3([H])C[C@@]4([H])C(C)=CC(=O)[C@@H](O)[C@]4(C)[C@@]([H])([C@@H](O)[C@H](O)[C@@H]1CO)[C@]23C |
| InChI | InChI=1S/C20H28O8/c1-7-4-10(22)17(26)19(2)9(7)5-11-20(3)12(14(24)18(27)28-11)8(6-21)13(23)15(25)16(19)20/h4,8-9,11-17,21,23-26H,5-6H2,1-3H3/t8-,9+,11-,12-,13-,14-,15+,16-,17-,19+,20+/m1/s1 |
| InChIKey | AFJYIZMCHVBLPP-YREBFMARSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Brucea mollis (ncbitaxon:43723) | stem (BTO:0001300) | PubMed (22070654) | Ethanolic extract of air-dried and powdered stems |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| yadanziolide T (CHEBI:68928) has parent hydride picrasane (CHEBI:36506) |
| yadanziolide T (CHEBI:68928) has role antineoplastic agent (CHEBI:35610) |
| yadanziolide T (CHEBI:68928) has role plant metabolite (CHEBI:76924) |
| yadanziolide T (CHEBI:68928) is a enone (CHEBI:51689) |
| yadanziolide T (CHEBI:68928) is a organic heterotetracyclic compound (CHEBI:38163) |
| yadanziolide T (CHEBI:68928) is a pentol (CHEBI:37205) |
| yadanziolide T (CHEBI:68928) is a quassinoid (CHEBI:72485) |
| yadanziolide T (CHEBI:68928) is a secondary α-hydroxy ketone (CHEBI:2468) |
| yadanziolide T (CHEBI:68928) is a δ-lactone (CHEBI:18946) |
| IUPAC Name |
|---|
| rel-(1β,11β,12α,15β)-1,11,12,15,21-pentahydroxypicras-3-ene-2,16-dione |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22123616 | Reaxys |
| Citations |
|---|