EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H23NO7 |
| Net Charge | 0 |
| Average Mass | 377.393 |
| Monoisotopic Mass | 377.14745 |
| SMILES | [H][C@]1(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)C(=O)c2c(nc3ccccc23)C1(C)C |
| InChI | InChI=1S/C19H23NO7/c1-19(2)16-11(8-5-3-4-6-9(8)20-16)13(23)17(19)27-18-15(25)14(24)12(22)10(7-21)26-18/h3-6,10,12,14-15,17-18,20-22,24-25H,7H2,1-2H3/t10-,12-,14+,15-,17+,18+/m1/s1 |
| InChIKey | OVQDAMWIXJSLMW-UZLGDHMWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Brucea mollis (ncbitaxon:43723) | stem (BTO:0001300) | PubMed (22070654) | Ethanolic extract of air-dried and powdered stems |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bruceolline K (CHEBI:68922) has role metabolite (CHEBI:25212) |
| bruceolline K (CHEBI:68922) has role plant metabolite (CHEBI:76924) |
| bruceolline K (CHEBI:68922) is a cyclic ketone (CHEBI:3992) |
| bruceolline K (CHEBI:68922) is a monosaccharide derivative (CHEBI:63367) |
| bruceolline K (CHEBI:68922) is a organic heterotricyclic compound (CHEBI:26979) |
| bruceolline K (CHEBI:68922) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| (2R)-3,3-dimethyl-1-oxo-1,2,3,4-tetrahydrocyclopenta[b]indol-2-yl β-D-glucopyranoside |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22123613 | Reaxys |
| Citations |
|---|