EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H52O12 |
| Net Charge | 0 |
| Average Mass | 676.800 |
| Monoisotopic Mass | 676.34588 |
| SMILES | [H][C@@]12CC=C3C(C)(C)C(=O)C(O[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)=C[C@@]3([H])[C@]1(C)C(=O)C[C@@]1(C)[C@@]2(C)C[C@@]2([H])O[C@H](C(C)(C)O)CC(=O)[C@](C)(O)[C@]12[H] |
| InChI | InChI=1S/C36H52O12/c1-31(2)16-9-10-21-33(5)13-19-28(36(8,45)22(38)12-24(46-19)32(3,4)44)34(33,6)14-23(39)35(21,7)17(16)11-18(29(31)43)47-30-27(42)26(41)25(40)20(15-37)48-30/h9,11,17,19-21,24-28,30,37,40-42,44-45H,10,12-15H2,1-8H3/t17-,19-,20-,21+,24+,25-,26+,27-,28+,30-,33+,34-,35+,36+/m1/s1 |
| InChIKey | IWNXFVRPEIWIJJ-VPLPWDSJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Machilus yaoshansis (ncbitaxon:251260) | root (BTO:0001188) | PubMed (22044245) | Ethanolic extract of air-dried and powdered roots |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. allelochemical A class of secondary metabolites developed by many plants to influence the behaviour, growth or survival of herbivores, and thus acting as a defence against herbivory. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (16alpha,20R,24S)-16,24-epoxy-2,20,25-trihydroxycucurbita-1,5-diene-3,11,22-trione 2-O-beta-D-glucopyranoside (CHEBI:68909) has role metabolite (CHEBI:25212) |
| (16alpha,20R,24S)-16,24-epoxy-2,20,25-trihydroxycucurbita-1,5-diene-3,11,22-trione 2-O-beta-D-glucopyranoside (CHEBI:68909) is a cucurbitacin (CHEBI:16219) |
| (16alpha,20R,24S)-16,24-epoxy-2,20,25-trihydroxycucurbita-1,5-diene-3,11,22-trione 2-O-beta-D-glucopyranoside (CHEBI:68909) is a glycoside (CHEBI:24400) |
| Citations |
|---|