EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H24NO3.C2F3O2 |
| Net Charge | 0 |
| Average Mass | 427.419 |
| Monoisotopic Mass | 427.16066 |
| SMILES | COc1cc2c(cc1O)C(Cc1ccc(O)cc1)[N+](C)(C)CC2.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C19H23NO3.C2HF3O2/c1-20(2)9-8-14-11-19(23-3)18(22)12-16(14)17(20)10-13-4-6-15(21)7-5-13;3-2(4,5)1(6)7/h4-7,11-12,17H,8-10H2,1-3H3,(H-,21,22);(H,6,7) |
| InChIKey | VQBCAYABASXBHJ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Gnetum montanum (ncbitaxon:3381) | leaf (BTO:0000713) | PubMed (22040053) | Organic extract of air-dried and ground leaves |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| magnocurarine trifluoroacetate, rac- (CHEBI:68906) has role metabolite (CHEBI:25212) |
| magnocurarine trifluoroacetate, rac- (CHEBI:68906) is a organic molecular entity (CHEBI:50860) |
| Synonym | Source |
|---|---|
| rac-Isoquinolinium, 1,2,3,4-tetrahydro-7-hydroxy-1-((4-hydroxyphenyl)methyl)-6-methoxy-2,2-dimethyl-trifluoroacetate | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 0006801407 | ChemIDplus |
| Citations |
|---|