EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H24NO4.C2F3O2 |
| Net Charge | 0 |
| Average Mass | 443.418 |
| Monoisotopic Mass | 443.15557 |
| SMILES | COc1cc2c(cc1O)C(Cc1ccc(O)c(O)c1)[N+](C)(C)CC2.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C19H23NO4.C2HF3O2/c1-20(2)7-6-13-10-19(24-3)18(23)11-14(13)15(20)8-12-4-5-16(21)17(22)9-12;3-2(4,5)1(6)7/h4-5,9-11,15H,6-8H2,1-3H3,(H2-,21,22,23);(H,6,7) |
| InChIKey | LJXVHGCCIANZFC-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Gnetum montanum (ncbitaxon:3381) | leaf (BTO:0000713) | PubMed (22040053) | Organic extract of air-dried and ground leaves |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rac-3'-hydroxy-N,N-dimethylcoclaurinium trifluoroacetate (CHEBI:68902) has role metabolite (CHEBI:25212) |
| rac-3'-hydroxy-N,N-dimethylcoclaurinium trifluoroacetate (CHEBI:68902) is a organic molecular entity (CHEBI:50860) |
| Citations |
|---|