EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H22NO4.C2F3O2 |
| Net Charge | 0 |
| Average Mass | 429.391 |
| Monoisotopic Mass | 429.13992 |
| SMILES | C[N+]1(C)CCc2cc(O)c(O)cc2C1Cc1ccc(O)c(O)c1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C18H21NO4.C2HF3O2/c1-19(2)6-5-12-9-17(22)18(23)10-13(12)14(19)7-11-3-4-15(20)16(21)8-11;3-2(4,5)1(6)7/h3-4,8-10,14H,5-7H2,1-2H3,(H3-,20,21,22,23);(H,6,7) |
| InChIKey | OIIROEYPLKNEAS-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Gnetum montanum (ncbitaxon:3381) | leaf (BTO:0000713) | PubMed (22040053) | Organic extract of air-dried and ground leaves |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rac-N-methyllaudanosolinium trifluoroacetate (CHEBI:68901) has role metabolite (CHEBI:25212) |
| rac-N-methyllaudanosolinium trifluoroacetate (CHEBI:68901) is a organic molecular entity (CHEBI:50860) |
| Synonym | Source |
|---|---|
| rac-1-(3,4-Dihydroxybenzyl)-6,7-dihydroxy-2,2-dimethyl-1,2,3,4-tetrahydroisoquinolinium trifluoroacetate | ChEBI |
| Citations |
|---|