EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C62H104O32 |
| Net Charge | 0 |
| Average Mass | 1361.482 |
| Monoisotopic Mass | 1360.65107 |
| SMILES | [H][C@@]1(O[C@H]2[C@H](OC(=O)/C(C)=C/C)[C@@H](O)[C@H](O[C@]3([H])[C@@H](O)[C@H](C)O[C@@]([H])(O[C@@H]4[C@H]5O[C@]6([H])O[C@H](CO)[C@@H](O)[C@H](O)[C@H]6OC(=O)CCCCCCCCC[C@H](CCCCC)O[C@@H]6O[C@H](C)[C@@H](O)[C@H](O)[C@H]6O[C@]4([H])O[C@H](CO)[C@H]5O)[C@@H]3OC(=O)[C@@H](C)CC)O[C@@H]2CO)O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C62H104O32/c1-8-11-17-20-31-21-18-15-13-12-14-16-19-22-36(67)87-51-44(75)40(71)33(24-64)84-60(51)92-49-41(72)34(25-65)85-62(93-52-43(74)37(68)29(6)80-59(52)82-31)54(49)94-61-53(89-56(79)28(5)10-3)48(38(69)30(7)81-61)91-58-46(77)50(88-55(78)27(4)9-2)47(35(26-66)86-58)90-57-45(76)42(73)39(70)32(23-63)83-57/h9,28-35,37-54,57-66,68-77H,8,10-26H2,1-7H3/b27-9+/t28-,29+,30-,31-,32+,33+,34+,35+,37+,38-,39+,40+,41+,42-,43-,44-,45+,46+,47+,48+,49-,50+,51+,52+,53+,54+,57-,58-,59-,60-,61-,62-/m0/s1 |
| InChIKey | NOCFVQPNEPRIJG-TYUKJMIASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Calystegia soldanella (ncbitaxon:136204) | |||
| leaf (BTO:0000713) | PubMed (21992192) | Methanolic extract of leaves,stems and roots | |
| root (BTO:0001188) | PubMed (21992192) | Methanolic extract of leaves,stems and roots | |
| stem (BTO:0001300) | PubMed (21992192) | Methanolic extract of leaves,stems and roots |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| calysolin IV (CHEBI:68899) has functional parent jalapinolic acid (CHEBI:75785) |
| calysolin IV (CHEBI:68899) has functional parent tiglic acid (CHEBI:9592) |
| calysolin IV (CHEBI:68899) has role metabolite (CHEBI:25212) |
| calysolin IV (CHEBI:68899) is a hexasaccharide derivative (CHEBI:63565) |
| calysolin IV (CHEBI:68899) is a macrocyclic lactone (CHEBI:63944) |
| calysolin IV (CHEBI:68899) is a resin glycoside (CHEBI:75756) |
| Synonym | Source |
|---|---|
| 11S-jalapinolic acid 11-O-β-D-glucopyranosyl-(1→4)-O-(3-O-tigloyl)-β-D-glucopyranosyl-(1→3)-O-(2-O-2S-methylbutyryl)-α-L-rhamnopyranosyl-(1→2)-[O-β-D-glucopyranosyl-(1→3)]-O-β-D-glucopyranosyl-(1→2)-β-D-quinovopyranoside, intramolecular 1,2''''-ester | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22105256 | Reaxys |
| Citations |
|---|