EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C66H110O30 |
| Net Charge | 0 |
| Average Mass | 1383.576 |
| Monoisotopic Mass | 1382.70819 |
| SMILES | [H][C@@]1(O[C@@H]2[C@H]3O[C@]4([H])O[C@H](CO[C@@H]5O[C@H](CO)[C@@H](O)[C@H](O)[C@H]5OC(=O)CCCCCCCCC[C@H](CCCCC)O[C@@H]5O[C@H](C)[C@@H](O)[C@H](O)[C@H]5O[C@]2([H])O[C@H](CO)[C@H]3O)[C@@H](OC(=O)[C@@H](C)CC)[C@H](OC(=O)[C@@H](C)CC)[C@H]4O)O[C@@H](C)[C@H](OC(=O)/C(C)=C/C)[C@@H](OC(=O)[C@@H](C)[C@H](C)O)[C@H]1O |
| InChI | InChI=1S/C66H110O30/c1-12-16-22-25-38-26-23-20-18-17-19-21-24-27-42(70)89-55-47(75)44(72)39(28-67)86-64(55)82-30-41-51(91-59(79)32(6)14-3)54(92-60(80)33(7)15-4)49(77)63(88-41)94-52-45(73)40(29-68)87-66(95-56-46(74)43(71)36(10)83-65(56)85-38)57(52)96-62-48(76)53(93-61(81)34(8)35(9)69)50(37(11)84-62)90-58(78)31(5)13-2/h13,32-41,43-57,62-69,71-77H,12,14-30H2,1-11H3/b31-13+/t32-,33-,34-,35-,36+,37-,38-,39+,40+,41+,43+,44+,45+,46-,47-,48+,49+,50-,51+,52-,53-,54+,55+,56+,57+,62-,63-,64+,65-,66-/m0/s1 |
| InChIKey | OBFQLSAPCYUFRB-CXKBSNDASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Calystegia soldanella (ncbitaxon:136204) | |||
| leaf (BTO:0000713) | PubMed (21992192) | Methanolic extract of leaves,stems and roots | |
| root (BTO:0001188) | PubMed (21992192) | Methanolic extract of leaves,stems and roots | |
| stem (BTO:0001300) | PubMed (21992192) | Methanolic extract of leaves,stems and roots |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| calysolin III (CHEBI:68898) has functional parent jalapinolic acid (CHEBI:75785) |
| calysolin III (CHEBI:68898) has functional parent tiglic acid (CHEBI:9592) |
| calysolin III (CHEBI:68898) has role metabolite (CHEBI:25212) |
| calysolin III (CHEBI:68898) is a macrocyclic lactone (CHEBI:63944) |
| calysolin III (CHEBI:68898) is a pentasaccharide derivative (CHEBI:63566) |
| calysolin III (CHEBI:68898) is a resin glycoside (CHEBI:75756) |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22105254 | Reaxys |
| Citations |
|---|