EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C50H86O23 |
| Net Charge | 0 |
| Average Mass | 1055.215 |
| Monoisotopic Mass | 1054.55599 |
| SMILES | [H][C@@]1(O[C@@H]2[C@H]3O[C@]4([H])O[C@H](CO)[C@@H](O)[C@H](OC(=O)[C@@H](C)CC)[C@H]4OC(=O)CCCCCCCCC[C@H](CCCCC)O[C@@H]4O[C@H](C)[C@@H](O)[C@H](O)[C@H]4O[C@]2([H])O[C@H](CO)[C@H]3O)O[C@@H](C)[C@H](O)[C@@H](O)[C@H]1OC(=O)[C@@H](C)[C@H](C)O |
| InChI | InChI=1S/C50H86O23/c1-8-10-16-19-29-20-17-14-12-11-13-15-18-21-32(54)68-43-39(69-45(61)24(3)9-2)35(57)30(22-51)66-49(43)71-40-36(58)31(23-52)67-50(72-42-38(60)34(56)27(6)63-47(42)65-29)44(40)73-48-41(37(59)33(55)28(7)64-48)70-46(62)25(4)26(5)53/h24-31,33-44,47-53,55-60H,8-23H2,1-7H3/t24-,25-,26-,27+,28-,29-,30+,31+,33-,34+,35+,36+,37+,38-,39-,40-,41+,42+,43+,44+,47-,48-,49-,50-/m0/s1 |
| InChIKey | PEXGEFOIWGLTKE-CEAJFWEWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Calystegia soldanella (ncbitaxon:136204) | |||
| leaf (BTO:0000713) | PubMed (21992192) | Methanolic extract of leaves,stems and roots | |
| stem (BTO:0001300) | PubMed (21992192) | Methanolic extract of leaves,stems and roots | |
| root (BTO:0001188) | PubMed (21992192) | Methanolic extract of leaves,stems and roots |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| calysolin I (CHEBI:68896) has functional parent jalapinolic acid (CHEBI:75785) |
| calysolin I (CHEBI:68896) has role metabolite (CHEBI:25212) |
| calysolin I (CHEBI:68896) is a macrocyclic lactone (CHEBI:63944) |
| calysolin I (CHEBI:68896) is a resin glycoside (CHEBI:75756) |
| calysolin I (CHEBI:68896) is a tetrasaccharide derivative (CHEBI:63567) |
| Synonym | Source |
|---|---|
| 11S-jalapinolic acid 11-O-(2-O-2S,3S-niloyl)-α-L-rhamnopyranosyl-(1→2)-[O-(3-O-2S-methylbutyryl)-β-D-glucopyranosyl-(1→3)]-O-β-D-glucopyranosyl-(1→2)-β-D-qinovopyranoside,intramolecular 1,2''''-ester | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22105252 | Reaxys |
| Citations |
|---|