EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H46O |
| Net Charge | 0 |
| Average Mass | 410.686 |
| Monoisotopic Mass | 410.35487 |
| SMILES | [H][C@@]12CCC3=CC(=O)CC[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])CC[C@]1([H])[C@H](C)/C=C/C(CC)C(C)C |
| InChI | InChI=1S/C29H46O/c1-7-21(19(2)3)9-8-20(4)25-12-13-26-24-11-10-22-18-23(30)14-16-28(22,5)27(24)15-17-29(25,26)6/h8-9,18-21,24-27H,7,10-17H2,1-6H3/b9-8+/t20-,21?,24+,25-,26+,27+,28+,29-/m1/s1 |
| InChIKey | MKGZDUKUQPPHFM-KBEOWXOMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Croton gratissimus (ncbitaxon:316784) | leaf (BTO:0000713) | PubMed (22032651) | Combined hexane,methylene chloride,ethyl acetate and methanol extract of ground leaves |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 24-ethylcholesta-4,22-dien-3-one (CHEBI:68895) has role metabolite (CHEBI:25212) |
| 24-ethylcholesta-4,22-dien-3-one (CHEBI:68895) is a 3-oxo-Δ4 steroid (CHEBI:47909) |
| IUPAC Name |
|---|
| (22E,24ξ)-stigmasta-4,22-dien-3-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:15766024 | Reaxys |
| Citations |
|---|