EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C48H63N3O13 |
| Net Charge | 0 |
| Average Mass | 890.040 |
| Monoisotopic Mass | 889.43609 |
| SMILES | [H][C@]12C[C@H](OC(=O)C3C(c4ccccc4)C(C(=O)O[C@@H]4C[C@]5([H])C[C@@H](OC(=O)/C=C(\C)C(=O)O)C[C@@]4([H])N5C)C3(C)C(=O)O[C@@H]3C[C@]4([H])C[C@@H](O)C[C@@]3([H])N4C)C[C@]([H])([C@H](OC(=O)/C(C)=C\C)C1)N2C |
| InChI | InChI=1S/C48H63N3O13/c1-8-24(2)44(56)62-36-19-29-17-32(23-35(36)51(29)7)61-45(57)41-40(26-12-10-9-11-13-26)42(48(41,4)47(59)64-38-18-27-15-30(52)21-33(38)49(27)5)46(58)63-37-20-28-16-31(22-34(37)50(28)6)60-39(53)14-25(3)43(54)55/h8-14,27-38,40-42,52H,15-23H2,1-7H3,(H,54,55)/b24-8-,25-14+/t27-,28-,29-,30+,31+,32-,33+,34+,35+,36+,37+,38+,40?,41?,42?,48?/m0/s1 |
| InChIKey | JFDUSOBIQVQCGI-WGXAKPSISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Schizanthus grahamii (ncbitaxon:360628) | aerial part (BTO:0001658) | PubMed (22047009) | Ethanolic extract of dried and powdered aerial parts |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Grahamine E, (rel)-1 (CHEBI:68894) has functional parent pentacarboxylic acid (CHEBI:35743) |
| Grahamine E, (rel)-1 (CHEBI:68894) has role metabolite (CHEBI:25212) |
| Grahamine E, (rel)-1 (CHEBI:68894) is a organooxygen compound (CHEBI:36963) |
| Synonym | Source |
|---|---|
| rel-1-{[(3alpha-mesaconyloxytropo-6beta-yl)oxy]carbonyl}-2-{[(3alpha-hydroxytropo-6beta-yl)oxy]carbonyl}-2-methyl-3-{[((6beta-angeloyloxy)-3alpha-yl)oxy]carbonyl}-4-phenylcyclobutanecarboxylate | ChEBI |
| Citations |
|---|