EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C43H59N3O10 |
| Net Charge | 0 |
| Average Mass | 777.956 |
| Monoisotopic Mass | 777.42005 |
| SMILES | [H][C@]12C[C@H](OC(=O)C3C(c4ccccc4)C(C(=O)O[C@@H]4C[C@]5([H])C[C@@H](O)C[C@@]4([H])N5C)C3(C)C(=O)O[C@@H]3C[C@]4([H])C[C@@H](O)C[C@@]3([H])N4C)C[C@]([H])([C@H](OC(=O)/C(C)=C\C)C1)N2C |
| InChI | InChI=1S/C43H59N3O10/c1-7-22(2)39(49)54-34-18-26-15-29(21-32(34)46(26)6)53-40(50)37-36(23-11-9-8-10-12-23)38(41(51)55-33-16-24-13-27(47)19-30(33)44(24)4)43(37,3)42(52)56-35-17-25-14-28(48)20-31(35)45(25)5/h7-12,24-38,47-48H,13-21H2,1-6H3/b22-7-/t24-,25-,26-,27+,28+,29-,30+,31+,32+,33+,34+,35+,36?,37?,38?,43?/m0/s1 |
| InChIKey | BAWQSJNAIYVRIL-DGXFYYPGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Schizanthus grahamii (ncbitaxon:360628) | aerial part (BTO:0001658) | PubMed (22047009) | Ethanolic extract of dried and powdered aerial parts |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Grahamine D, (rel)- (CHEBI:68893) has functional parent tetracarboxylic acid (CHEBI:35742) |
| Grahamine D, (rel)- (CHEBI:68893) has role metabolite (CHEBI:25212) |
| Grahamine D, (rel)- (CHEBI:68893) is a organooxygen compound (CHEBI:36963) |
| Synonym | Source |
|---|---|
| rel-1,2-bis{[(3alpha-hydroxytropo-6beta-yl)oxy]carbonyl}-2-methyl-3-{[((6beta-angeloyloxy)-3alpha-yl)oxy]carbonyl}-4-phenylcyclobutanecarboxylate | ChEBI |
| Citations |
|---|