EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H46N2O9 |
| Net Charge | 0 |
| Average Mass | 638.758 |
| Monoisotopic Mass | 638.32033 |
| SMILES | [H][C@]12C[C@H](OC(=O)C3C(c4ccccc4)C(C(=O)O)C3(C)C(=O)O[C@@H]3C[C@]4([H])C[C@@H](O)C[C@@]3([H])N4C)C[C@]([H])([C@H](OC(=O)/C(C)=C\C)C1)N2C |
| InChI | InChI=1S/C35H46N2O9/c1-6-18(2)32(41)45-26-15-21-13-23(17-25(26)37(21)5)44-33(42)30-28(19-10-8-7-9-11-19)29(31(39)40)35(30,3)34(43)46-27-14-20-12-22(38)16-24(27)36(20)4/h6-11,20-30,38H,12-17H2,1-5H3,(H,39,40)/b18-6-/t20-,21-,22+,23-,24+,25+,26+,27+,28?,29?,30?,35?/m0/s1 |
| InChIKey | BUFUGHAGZDAHJK-DJJAPDROSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Schizanthus grahamii (ncbitaxon:360628) | aerial part (BTO:0001658) | PubMed (22047009) | Ethanolic extract of dried and powdered aerial parts |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Grahamine A, (rel)- (CHEBI:68890) has functional parent tetracarboxylic acid (CHEBI:35742) |
| Grahamine A, (rel)- (CHEBI:68890) has role metabolite (CHEBI:25212) |
| Grahamine A, (rel)- (CHEBI:68890) is a organooxygen compound (CHEBI:36963) |
| Synonym | Source |
|---|---|
| rel-2-{[(3alpha-hydroxytropo-6beta--yl)oxy]carbonyl}-2-methyl-3-{[((6beta-angeloyloxy)-3alpha-yl)oxy]carbonyl}-4-phenylcyclobutanecarboxylic acid | ChEBI |
| Citations |
|---|