EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H25N5O7 |
| Net Charge | 0 |
| Average Mass | 411.415 |
| Monoisotopic Mass | 411.17540 |
| SMILES | C[C@@H](O)[C@H](NC(=O)[C@H](CCCNC(=N)N)NC(=O)c1cccc(O)c1O)C(=O)O |
| InChI | InChI=1S/C17H25N5O7/c1-8(23)12(16(28)29)22-15(27)10(5-3-7-20-17(18)19)21-14(26)9-4-2-6-11(24)13(9)25/h2,4,6,8,10,12,23-25H,3,5,7H2,1H3,(H,21,26)(H,22,27)(H,28,29)(H4,18,19,20)/t8-,10+,12+/m1/s1 |
| InChIKey | RYFDAFYFFUVLNW-QRTLGDNMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces species YM5-799 (ncbitaxon:693414) | - | PubMed (22014204) | Streptomyces sp. YM5-799 strain was isolated from a brown alga[Analipus japonicus (Harvey) Wynne] |
| Streptomyces xanthophaeus (ncbitaxon:67385) | - | PubMed (22014204) | Strain: MJ244 SF1 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| benarthin (CHEBI:68888) has role metabolite (CHEBI:25212) |
| benarthin (CHEBI:68888) is a peptide (CHEBI:16670) |
| Synonyms | Source |
|---|---|
| L-N-(2,3-dihydroxybenzoyl)arginyl-L-threonine | ChEBI |
| (2S,3R)-2-[[(2S)-5-(diaminomethylideneamino)-2-[(2,3-dihydroxybenzoyl)amino]pentanoyl]amino]-3-hydroxybutanoic acid | ChEBI |
| N5-(Diaminomethylene)-N2-(2,3-dihydroxybenzoyl)-L-ornithyl-L-threonine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 0143651450 | ChemIDplus |
| Citations |
|---|