EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H48N10O13 |
| Net Charge | 0 |
| Average Mass | 804.815 |
| Monoisotopic Mass | 804.34023 |
| SMILES | C[C@@H](O)[C@H](NC(=O)[C@H](CCCNC(=N)N)NC(=O)c1cccc(O)c1O)C(=O)O[C@H](C)[C@H](NC(=O)[C@H](CCCNC(=N)N)NC(=O)c1cccc(O)c1O)C(=O)O |
| InChI | InChI=1S/C34H48N10O13/c1-15(45)23(43-29(52)19(9-5-13-39-33(35)36)41-27(50)17-7-3-11-21(46)25(17)48)32(56)57-16(2)24(31(54)55)44-30(53)20(10-6-14-40-34(37)38)42-28(51)18-8-4-12-22(47)26(18)49/h3-4,7-8,11-12,15-16,19-20,23-24,45-49H,5-6,9-10,13-14H2,1-2H3,(H,41,50)(H,42,51)(H,43,52)(H,44,53)(H,54,55)(H4,35,36,39)(H4,37,38,40)/t15-,16-,19+,20+,23+,24+/m1/s1 |
| InChIKey | WUGMTNYESVFCDC-MEVGPWJASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces species YM5-799 (ncbitaxon:693414) | - | PubMed (22014204) | Streptomyces sp. YM5-799 strain was isolated from a brown alga[Analipus japonicus (Harvey) Wynne] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dibenarthin (CHEBI:68886) has role metabolite (CHEBI:25212) |
| dibenarthin (CHEBI:68886) is a peptide (CHEBI:16670) |
| Synonym | Source |
|---|---|
| N2-(2,3-Dihydroxybenzoyl)-L-arginyl-O-[(2S,3R)-2-{[N2-(2,3-dihydroxybenzoyl)-L-arginyl]amino}-3-hydroxybutanoyl]-L-threonine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 27025794 | ChemSpider |
| Citations |
|---|