EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C51H69N15O18 |
| Net Charge | 0 |
| Average Mass | 1180.200 |
| Monoisotopic Mass | 1179.49450 |
| SMILES | C[C@H]1OC(=O)[C@@H](NC(=O)[C@H](CCCNC(=N)N)NC(=O)c2cccc(O)c2O)[C@@H](C)OC(=O)[C@@H](NC(=O)[C@H](CCCNC(=N)N)NC(=O)c2cccc(O)c2O)[C@@H](C)OC(=O)[C@H]1NC(=O)[C@H](CCCNC(=N)N)NC(=O)c1cccc(O)c1O |
| InChI | InChI=1S/C51H69N15O18/c1-22-34(64-43(76)28(13-7-19-58-49(52)53)61-40(73)25-10-4-16-31(67)37(25)70)46(79)83-24(3)36(66-45(78)30(15-9-21-60-51(56)57)63-42(75)27-12-6-18-33(69)39(27)72)48(81)84-23(2)35(47(80)82-22)65-44(77)29(14-8-20-59-50(54)55)62-41(74)26-11-5-17-32(68)38(26)71/h4-6,10-12,16-18,22-24,28-30,34-36,67-72H,7-9,13-15,19-21H2,1-3H3,(H,61,73)(H,62,74)(H,63,75)(H,64,76)(H,65,77)(H,66,78)(H4,52,53,58)(H4,54,55,59)(H4,56,57,60)/t22-,23-,24-,28+,29+,30+,34+,35+,36+/m1/s1 |
| InChIKey | WLSGYSOOUFLHHA-XKCQZYHGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces species YM5-799 (ncbitaxon:693414) | - | PubMed (22014204) | Streptomyces sp. YM5-799 strain was isolated from a brown alga[Analipus japonicus (Harvey) Wynne] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Streptobactin (CHEBI:68885) has role metabolite (CHEBI:25212) |
| Streptobactin (CHEBI:68885) is a cyclodepsipeptide (CHEBI:35213) |
| Synonym | Source |
|---|---|
| Benzamide, N,N',N''-[[(2R,3S,6R,7S,10R,11S)-2,6,10-trimethyl-4,8,12-trioxo-1,5,9-trioxacyclododecane-3,7,11-triyl]tris[imino[(1S)-1-[3-[(aminoiminomethyl)amino]propyl]-2-oxo-2,1-ethanediyl]]]tris[2,3- dihydroxy- | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 27025793 | ChemSpider |
| Citations |
|---|