EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H28O14 |
| Net Charge | 0 |
| Average Mass | 564.496 |
| Monoisotopic Mass | 564.14791 |
| SMILES | C[C@@H]1O[C@@H](Oc2cc(O)c3c(=O)c(O[C@@H]4OC[C@](O)(CO)[C@H]4O)c(-c4ccc(O)cc4)oc3c2)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C26H28O14/c1-10-17(30)19(32)20(33)24(37-10)38-13-6-14(29)16-15(7-13)39-21(11-2-4-12(28)5-3-11)22(18(16)31)40-25-23(34)26(35,8-27)9-36-25/h2-7,10,17,19-20,23-25,27-30,32-35H,8-9H2,1H3/t10-,17-,19+,20+,23-,24-,25-,26+/m0/s1 |
| InChIKey | SVQKJHRWPYLYKM-BRPMHDARSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lotus edulis (ncbitaxon:181270) | |||
| branch (BTO:0000148) | PubMed (22014228) | Methanolic extract of leaves and branches | |
| leaf (BTO:0000713) | PubMed (22014228) | Methanolic extract of leaves and branches | |
| Vicia faba (ncbitaxon:3906) | |||
| leaf (BTO:0000713) | PubMed (22014228) | Methanolic extract of leaves and branches | |
| branch (BTO:0000148) | PubMed (22014228) | Methanolic extract of leaves and branches |
| Roles Classification |
|---|
| Biological Roles: | EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor A topoisomerase inhibitor that inhibits DNA topoisomerase (ATP-hydrolysing), EC 5.99.1.3 (also known as topoisomerase II and as DNA gyrase), which catalyses ATP-dependent breakage of both strands of DNA, passage of the unbroken strands through the breaks, and rejoining of the broken strands. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| kaempferol 3-O-β-D-apiofuranosyl-7-O-α-L-rhamnopyranoside (CHEBI:68884) has functional parent kaempferol (CHEBI:28499) |
| kaempferol 3-O-β-D-apiofuranosyl-7-O-α-L-rhamnopyranoside (CHEBI:68884) has role EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor (CHEBI:50750) |
| kaempferol 3-O-β-D-apiofuranosyl-7-O-α-L-rhamnopyranoside (CHEBI:68884) has role metabolite (CHEBI:25212) |
| kaempferol 3-O-β-D-apiofuranosyl-7-O-α-L-rhamnopyranoside (CHEBI:68884) has role plant metabolite (CHEBI:76924) |
| kaempferol 3-O-β-D-apiofuranosyl-7-O-α-L-rhamnopyranoside (CHEBI:68884) is a dihydroxyflavone (CHEBI:38686) |
| kaempferol 3-O-β-D-apiofuranosyl-7-O-α-L-rhamnopyranoside (CHEBI:68884) is a glycosyloxyflavone (CHEBI:50018) |
| kaempferol 3-O-β-D-apiofuranosyl-7-O-α-L-rhamnopyranoside (CHEBI:68884) is a α-L-rhamnoside (CHEBI:27848) |
| IUPAC Name |
|---|
| 3-{[(2S,3R,4R)-3,4-dihydroxy-4-(hydroxymethyl)tetrahydrofuran-2-yl]oxy}-5-hydroxy-2-(4-hydroxyphenyl)-4-oxo-4H-chromen-7-yl 6-deoxy-α-L-mannopyranoside |
| Citations |
|---|