EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H28O14 |
| Net Charge | 0 |
| Average Mass | 564.496 |
| Monoisotopic Mass | 564.14791 |
| SMILES | C[C@@H]1O[C@@H](Oc2cc(O)c3c(=O)c(O[C@@H]4OC[C@](O)(CO)[C@H]4O)c(-c4ccc(O)cc4)oc3c2)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C26H28O14/c1-10-17(30)19(32)20(33)24(37-10)38-13-6-14(29)16-15(7-13)39-21(11-2-4-12(28)5-3-11)22(18(16)31)40-25-23(34)26(35,8-27)9-36-25/h2-7,10,17,19-20,23-25,27-30,32-35H,8-9H2,1H3/t10-,17-,19+,20+,23-,24-,25-,26+/m0/s1 |
| InChIKey | SVQKJHRWPYLYKM-BRPMHDARSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lotus edulis (ncbitaxon:181270) | |||
| branch (BTO:0000148) | PubMed (22014228) | Methanolic extract of leaves and branches | |
| leaf (BTO:0000713) | PubMed (22014228) | Methanolic extract of leaves and branches | |
| Vicia faba (ncbitaxon:3906) | |||
| leaf (BTO:0000713) | PubMed (22014228) | Methanolic extract of leaves and branches | |
| branch (BTO:0000148) | PubMed (22014228) | Methanolic extract of leaves and branches |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor A topoisomerase inhibitor that inhibits DNA topoisomerase (ATP-hydrolysing), EC 5.99.1.3 (also known as topoisomerase II and as DNA gyrase), which catalyses ATP-dependent breakage of both strands of DNA, passage of the unbroken strands through the breaks, and rejoining of the broken strands. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| kaempferol 3-O-β-D-apiofuranosyl-7-O-α-L-rhamnopyranoside (CHEBI:68884) has functional parent kaempferol (CHEBI:28499) |
| kaempferol 3-O-β-D-apiofuranosyl-7-O-α-L-rhamnopyranoside (CHEBI:68884) has role EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor (CHEBI:50750) |
| kaempferol 3-O-β-D-apiofuranosyl-7-O-α-L-rhamnopyranoside (CHEBI:68884) has role metabolite (CHEBI:25212) |
| kaempferol 3-O-β-D-apiofuranosyl-7-O-α-L-rhamnopyranoside (CHEBI:68884) has role plant metabolite (CHEBI:76924) |
| kaempferol 3-O-β-D-apiofuranosyl-7-O-α-L-rhamnopyranoside (CHEBI:68884) is a dihydroxyflavone (CHEBI:38686) |
| kaempferol 3-O-β-D-apiofuranosyl-7-O-α-L-rhamnopyranoside (CHEBI:68884) is a glycosyloxyflavone (CHEBI:50018) |
| kaempferol 3-O-β-D-apiofuranosyl-7-O-α-L-rhamnopyranoside (CHEBI:68884) is a α-L-rhamnoside (CHEBI:27848) |
| IUPAC Name |
|---|
| 3-{[(2S,3R,4R)-3,4-dihydroxy-4-(hydroxymethyl)tetrahydrofuran-2-yl]oxy}-5-hydroxy-2-(4-hydroxyphenyl)-4-oxo-4H-chromen-7-yl 6-deoxy-α-L-mannopyranoside |
| Citations |
|---|