EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H30O5 |
| Net Charge | 0 |
| Average Mass | 374.477 |
| Monoisotopic Mass | 374.20932 |
| SMILES | [H][C@@]12CC[C@](O)(C(=O)CO)[C@@]1(C)C[C@H](O)[C@@]1([H])[C@@]2([H])C[C@H](C)C2=CC(=O)C=C[C@@]21C |
| InChI | InChI=1S/C22H30O5/c1-12-8-14-15-5-7-22(27,18(26)11-23)21(15,3)10-17(25)19(14)20(2)6-4-13(24)9-16(12)20/h4,6,9,12,14-15,17,19,23,25,27H,5,7-8,10-11H2,1-3H3/t12-,14-,15-,17-,19+,20-,21-,22-/m0/s1 |
| InChIKey | VHRSUDSXCMQTMA-PJHHCJLFSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Roles: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. adrenergic agent Any agent that acts on an adrenergic receptor or affects the life cycle of an adrenergic transmitter. |
| Applications: | anti-inflammatory drug A substance that reduces or suppresses inflammation. antiemetic A drug used to prevent nausea or vomiting. An antiemetic may act by a wide range of mechanisms: it might affect the medullary control centres (the vomiting centre and the chemoreceptive trigger zone) or affect the peripheral receptors. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. adrenergic agent Any agent that acts on an adrenergic receptor or affects the life cycle of an adrenergic transmitter. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6α-methylprednisolone (CHEBI:6888) has role adrenergic agent (CHEBI:37962) |
| 6α-methylprednisolone (CHEBI:6888) has role anti-inflammatory drug (CHEBI:35472) |
| 6α-methylprednisolone (CHEBI:6888) has role antiemetic (CHEBI:50919) |
| 6α-methylprednisolone (CHEBI:6888) has role environmental contaminant (CHEBI:78298) |
| 6α-methylprednisolone (CHEBI:6888) has role neuroprotective agent (CHEBI:63726) |
| 6α-methylprednisolone (CHEBI:6888) has role xenobiotic (CHEBI:35703) |
| 6α-methylprednisolone (CHEBI:6888) is a 6-methylprednisolone (CHEBI:50366) |
| 6α-methylprednisolone (CHEBI:6888) is a primary α-hydroxy ketone (CHEBI:139590) |
| 6α-methylprednisolone (CHEBI:6888) is a tertiary α-hydroxy ketone (CHEBI:139592) |
| Incoming Relation(s) |
| methylprednisolone 21-suleptanic acid ester (CHEBI:156480) has functional parent 6α-methylprednisolone (CHEBI:6888) |
| methylprednisolone acetate (CHEBI:6889) has functional parent 6α-methylprednisolone (CHEBI:6888) |
| IUPAC Name |
|---|
| 11β,17,21-trihydroxy-6α-methylpregna-1,4-diene-3,20-dione |
| INNs | Source |
|---|---|
| methylprednisolonum | ChemIDplus |
| metilprednisolona | ChemIDplus |
| methylprednisolone | KEGG DRUG |
| Synonyms | Source |
|---|---|
| (6α,11β)-11,17,21-trihydroxy-6-methylpregna-1,4-diene-3,20-dione | NIST Chemistry WebBook |
| Δ1-6α-methylhydrocortisone | NIST Chemistry WebBook |
| 1-dehydro-6α-methylhydrocortisone | ChemIDplus |
| Methylprednisolon | ChEBI |
| 6α-methyl-11β,17α,21-triol-1,4-pregnadiene-3,20-dione | ChemIDplus |
| Brand Names | Source |
|---|---|
| Medrol | KEGG DRUG |
| Solomet | DrugBank |
| Medrone | DrugBank |
| Urbason | DrugBank |
| Medrate | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D00407 | KEGG DRUG |
| DB00959 | DrugBank |
| US3053832 | Patent |
| US2897218 | Patent |
| Methylprednisolone | Wikipedia |
| HMDB0015094 | HMDB |
| 1768 | DrugCentral |
| 1936 | VSDB |
| Citations |
|---|