EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H50O |
| Net Charge | 0 |
| Average Mass | 426.729 |
| Monoisotopic Mass | 426.38617 |
| SMILES | [H][C@@]12CC(C)(C)CC[C@]1(C)CC[C@]1(C)[C@@]3([H])CC=C4C(C)(C)[C@H](O)CC[C@@]4([H])[C@]3(C)CC[C@@]21C |
| InChI | InChI=1S/C30H50O/c1-25(2)13-14-27(5)15-17-29(7)22-11-9-20-21(10-12-24(31)26(20,3)4)28(22,6)16-18-30(29,8)23(27)19-25/h9,21-24,31H,10-19H2,1-8H3/t21-,22+,23-,24-,27-,28+,29-,30+/m1/s1 |
| InChIKey | HFSACQSILLSUII-VXRRTDEQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Croton gratissimus (ncbitaxon:316784) | |||
| stem (BTO:0001300) | PubMed (22032651) | Previous component: stem bark; Combined hexane,methylene chloride,ethyl acetate and methanol extract of Ground leaves | |
| leaf (BTO:0000713) | PubMed (22032651) | Combined hexane,methylene chloride,ethyl acetate and methanol extract of Ground leaves |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| alpha-glutinol (CHEBI:68874) has role metabolite (CHEBI:25212) |
| alpha-glutinol (CHEBI:68874) is a organic hydroxy compound (CHEBI:33822) |
| Citations |
|---|