EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30O5 |
| Net Charge | 0 |
| Average Mass | 350.455 |
| Monoisotopic Mass | 350.20932 |
| SMILES | [H][C@]12C=C(CC[C@](O)(C(C)C)/C=C/[C@](C)(O)C/C=C/[C@@](C)(O)C1)C(=O)O2 |
| InChI | InChI=1S/C20H30O5/c1-14(2)20(24)9-6-15-12-16(25-17(15)21)13-19(4,23)8-5-7-18(3,22)10-11-20/h5,8,10-12,14,16,22-24H,6-7,9,13H2,1-4H3/b8-5+,11-10+/t16-,18+,19+,20+/m0/s1 |
| InChIKey | PZFBVODTZGEVTO-MCERNNHQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Croton gratissimus (ncbitaxon:316784) | leaf (BTO:0000713) | PubMed (22032651) | Combined hexane,methylene chloride,ethyl acetate and methanol extract of Ground leaves |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rel-(+)-(1S,4R,8S,10R)-1,4,8-trihydroxycembra-2E,6E,11Z-trien-20,10-olide (CHEBI:68873) has role metabolite (CHEBI:25212) |
| rel-(+)-(1S,4R,8S,10R)-1,4,8-trihydroxycembra-2E,6E,11Z-trien-20,10-olide (CHEBI:68873) is a cembrane diterpenoid (CHEBI:60687) |
| rel-(+)-(1S,4R,8S,10R)-1,4,8-trihydroxycembra-2E,6E,11Z-trien-20,10-olide (CHEBI:68873) is a diterpene lactone (CHEBI:49193) |
| rel-(+)-(1S,4R,8S,10R)-1,4,8-trihydroxycembra-2E,6E,11Z-trien-20,10-olide (CHEBI:68873) is a macrocycle (CHEBI:51026) |
| rel-(+)-(1S,4R,8S,10R)-1,4,8-trihydroxycembra-2E,6E,11Z-trien-20,10-olide (CHEBI:68873) is a triol (CHEBI:27136) |
| IUPAC Name |
|---|
| (4S*,5E,7R*,9E,11S*,13R*)-4,7,11-trihydroxy-7,11-dimethyl-4-(propan-2-yl)-14-oxabicyclo[11.2.1]hexadeca-1(16),5,9-trien-15-one |
| Citations |
|---|