EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H28O3 |
| Net Charge | 0 |
| Average Mass | 328.452 |
| Monoisotopic Mass | 328.20384 |
| SMILES | [H][C@]12C=C(CC/C(C(=C)C)=C\C=C(/C)[C@H](OC)C/C=C(\C)C1)C(=O)O2 |
| InChI | InChI=1S/C21H28O3/c1-14(2)17-8-7-16(4)20(23-5)11-6-15(3)12-19-13-18(10-9-17)21(22)24-19/h6-8,13,19-20H,1,9-12H2,2-5H3/b15-6+,16-7+,17-8+/t19-,20-/m1/s1 |
| InChIKey | NQLWXHKCOGCSFI-PVHWGTCTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Croton gratissimus (ncbitaxon:316784) | leaf (BTO:0000713) | PubMed (22032651) | Combined hexane,methylene chloride,ethyl acetate and methanol extract of Ground leaves |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rel-(+)-(5R,10R)-5-methoxycembra-1E,3E,7E,11Z,15-pentaen-20,10-olide (CHEBI:68870) has role metabolite (CHEBI:25212) |
| rel-(+)-(5R,10R)-5-methoxycembra-1E,3E,7E,11Z,15-pentaen-20,10-olide (CHEBI:68870) is a cembrane diterpenoid (CHEBI:60687) |
| rel-(+)-(5R,10R)-5-methoxycembra-1E,3E,7E,11Z,15-pentaen-20,10-olide (CHEBI:68870) is a diterpene lactone (CHEBI:49193) |
| rel-(+)-(5R,10R)-5-methoxycembra-1E,3E,7E,11Z,15-pentaen-20,10-olide (CHEBI:68870) is a ether (CHEBI:25698) |
| rel-(+)-(5R,10R)-5-methoxycembra-1E,3E,7E,11Z,15-pentaen-20,10-olide (CHEBI:68870) is a macrocycle (CHEBI:51026) |
| IUPAC Name |
|---|
| (4E,6E,8R*,10E,13R*)-8-methoxy-7,11-dimethyl-4-(prop-1-en-2-yl)-14-oxabicyclo[11.2.1]hexadeca-1(16),4,6,10-tetraen-15-one |
| Citations |
|---|