EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H26O2 |
| Net Charge | 0 |
| Average Mass | 298.426 |
| Monoisotopic Mass | 298.19328 |
| SMILES | [H][C@]12C=C(CC/C(C(=C)C)=C\C=C(/C)CC/C=C(\C)C1)C(=O)O2 |
| InChI | InChI=1S/C20H26O2/c1-14(2)17-9-8-15(3)6-5-7-16(4)12-19-13-18(11-10-17)20(21)22-19/h7-9,13,19H,1,5-6,10-12H2,2-4H3/b15-8+,16-7+,17-9+/t19-/m1/s1 |
| InChIKey | KGUUUDYKWYRRMZ-KTFRZDGWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Croton gratissimus (ncbitaxon:316784) | leaf (BTO:0000713) | PubMed (22032651) | Combined hexane,methylene chloride,ethyl acetate and methanol extract of Ground leaves |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rel-(+)-(10R)-cembra-1E,3E,7E,11Z,15-pentaen-20,10-olide (CHEBI:68868) has role metabolite (CHEBI:25212) |
| rel-(+)-(10R)-cembra-1E,3E,7E,11Z,15-pentaen-20,10-olide (CHEBI:68868) is a cembrane diterpenoid (CHEBI:60687) |
| rel-(+)-(10R)-cembra-1E,3E,7E,11Z,15-pentaen-20,10-olide (CHEBI:68868) is a diterpene lactone (CHEBI:49193) |
| rel-(+)-(10R)-cembra-1E,3E,7E,11Z,15-pentaen-20,10-olide (CHEBI:68868) is a macrocycle (CHEBI:51026) |
| IUPAC Name |
|---|
| (4E,6E,10E,13R*)-7,11-dimethyl-4-(prop-1-en-2-yl)-14-oxabicyclo[11.2.1]hexadeca-1(16),4,6,10-tetraen-15-one |
| Citations |
|---|