EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30O3 |
| Net Charge | 0 |
| Average Mass | 318.457 |
| Monoisotopic Mass | 318.21949 |
| SMILES | [H][C@]12C=C(CC[C@H](C(C)C)/C=C/[C@@](C)(O)CC/C=C(\C)C1)C(=O)O2 |
| InChI | InChI=1S/C20H30O3/c1-14(2)16-7-8-17-13-18(23-19(17)21)12-15(3)6-5-10-20(4,22)11-9-16/h6,9,11,13-14,16,18,22H,5,7-8,10,12H2,1-4H3/b11-9+,15-6+/t16-,18+,20-/m0/s1 |
| InChIKey | KLOZYZWTTNSEEN-IBKADNNNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Croton gratissimus (ncbitaxon:316784) | |||
| stem (BTO:0001300) | PubMed (22032651) | Previous component: stem bark; Combined hexane,methylene chloride,ethyl acetate and methanol extract of Ground leaves | |
| leaf (BTO:0000713) | PubMed (22032651) | Combined hexane,methylene chloride,ethyl acetate and methanol extract of Ground leaves |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rel-(+)-(1R,4S,10R)-4-hydroxycembra-2E,7E,11Z-trien-20,10-olide (CHEBI:68867) has role metabolite (CHEBI:25212) |
| rel-(+)-(1R,4S,10R)-4-hydroxycembra-2E,7E,11Z-trien-20,10-olide (CHEBI:68867) is a cembrane diterpenoid (CHEBI:60687) |
| rel-(+)-(1R,4S,10R)-4-hydroxycembra-2E,7E,11Z-trien-20,10-olide (CHEBI:68867) is a diterpene lactone (CHEBI:49193) |
| rel-(+)-(1R,4S,10R)-4-hydroxycembra-2E,7E,11Z-trien-20,10-olide (CHEBI:68867) is a macrocycle (CHEBI:51026) |
| rel-(+)-(1R,4S,10R)-4-hydroxycembra-2E,7E,11Z-trien-20,10-olide (CHEBI:68867) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| (4R*,5E,7S*,10E,13R*)-7-hydroxy-7,11-dimethyl-4-(propan-2-yl)-14-oxabicyclo[11.2.1]hexadeca-1(16),5,10-trien-15-one |
| Citations |
|---|