EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H32O3 |
| Net Charge | 0 |
| Average Mass | 332.484 |
| Monoisotopic Mass | 332.23514 |
| SMILES | [H][C@]12C=C(CC[C@H](C(C)C)/C=C/[C@](C)(OC)CC/C=C(\C)C1)C(=O)O2 |
| InChI | InChI=1S/C21H32O3/c1-15(2)17-8-9-18-14-19(24-20(18)22)13-16(3)7-6-11-21(4,23-5)12-10-17/h7,10,12,14-15,17,19H,6,8-9,11,13H2,1-5H3/b12-10+,16-7+/t17-,19+,21+/m0/s1 |
| InChIKey | ZRACFAVCRYEYFL-SPRANPSHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Croton gratissimus (ncbitaxon:316784) | leaf (BTO:0000713) | PubMed (22032651) | Combined hexane,methylene chloride,ethyl acetate and methanol extract of Ground leaves |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rel-(−)-(1R,4R,10R)-4-methoxycembra-2E,7E,11Z-trien-20,10-olide (CHEBI:68863) has role metabolite (CHEBI:25212) |
| rel-(−)-(1R,4R,10R)-4-methoxycembra-2E,7E,11Z-trien-20,10-olide (CHEBI:68863) is a cembrane diterpenoid (CHEBI:60687) |
| rel-(−)-(1R,4R,10R)-4-methoxycembra-2E,7E,11Z-trien-20,10-olide (CHEBI:68863) is a diterpene lactone (CHEBI:49193) |
| rel-(−)-(1R,4R,10R)-4-methoxycembra-2E,7E,11Z-trien-20,10-olide (CHEBI:68863) is a ether (CHEBI:25698) |
| rel-(−)-(1R,4R,10R)-4-methoxycembra-2E,7E,11Z-trien-20,10-olide (CHEBI:68863) is a macrocycle (CHEBI:51026) |
| IUPAC Name |
|---|
| (4R*,5E,7R*,10E,13R*)-7-methoxy-7,11-dimethyl-4-(propan-2-yl)-14-oxabicyclo[11.2.1]hexadeca-1(16),5,10-trien-15-one |
| Citations |
|---|