EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H28O6 |
| Net Charge | 0 |
| Average Mass | 424.493 |
| Monoisotopic Mass | 424.18859 |
| SMILES | CC(C)=CCOc1c(C)cc2oc3c(CC4OC4(C)C)ccc(O)c3c(=O)c2c1CO |
| InChI | InChI=1S/C25H28O6/c1-13(2)8-9-29-23-14(3)10-18-20(16(23)12-26)22(28)21-17(27)7-6-15(24(21)30-18)11-19-25(4,5)31-19/h6-8,10,19,26-27H,9,11-12H2,1-5H3 |
| InChIKey | ROWGCYHEZVANDZ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus (ncbitaxon:5052) | - | PubMed (22026385) |
| Roles Classification |
|---|
| Biological Role: | Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| variecoxanthone C (CHEBI:68862) has role Aspergillus metabolite (CHEBI:76956) |
| variecoxanthone C (CHEBI:68862) is a aromatic primary alcohol (CHEBI:33857) |
| variecoxanthone C (CHEBI:68862) is a epoxide (CHEBI:32955) |
| variecoxanthone C (CHEBI:68862) is a phenols (CHEBI:33853) |
| variecoxanthone C (CHEBI:68862) is a xanthones (CHEBI:51149) |
| IUPAC Name |
|---|
| 5-[(3,3-dimethyloxiran-2-yl)methyl]-8-hydroxy-1-(hydroxymethyl)-3-methyl-2-[(3-methylbut-2-en-1-yl)oxy]-9H-xanthen-9-one |
| Citations |
|---|