EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H9ClN2O5S2 |
| Net Charge | 0 |
| Average Mass | 360.800 |
| Monoisotopic Mass | 359.96414 |
| SMILES | [H][C@]12NC(=O)[C@]3(Oc4cc(O)c(Cl)cc4[C@]3([H])SS1)N(OC)C2=O |
| InChI | InChI=1S/C12H9ClN2O5S2/c1-19-15-10(17)9-14-11(18)12(15)8(21-22-9)4-2-5(13)6(16)3-7(4)20-12/h2-3,8-9,16H,1H3,(H,14,18)/t8-,9-,12-/m0/s1 |
| InChIKey | XMFSSFONDVHNFO-AUTRQRHGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus oryzae (ncbitaxon:5062) | - | PubMed (22026385) |
| Roles Classification |
|---|
| Biological Role: | Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Aspirochlorine (CHEBI:68861) has role Aspergillus metabolite (CHEBI:76956) |
| Aspirochlorine (CHEBI:68861) is a organic heterotetracyclic compound (CHEBI:38163) |
| Synonyms | Source |
|---|---|
| (1R,9S,12S)-6-Chloro-5-hydroxy-15-methoxy-2-oxa-10,11-dithia-13,15-diazatetracyclo[10.2.2.0(1,9).0(3,8)]hexadeca-3,5,7-triene-14,16-dione | ChEBI |
| (3S,5aR,10bS)-9-chloro-8-hydroxy-11-methoxy-3,4-dihydro-5H,10bH-5a,3-(epiminomethano)[1]benzofuro[2,3-f][1,2,4]dithiazepine-5,12-dione | ChEBI |
| Citations |
|---|