EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H28O6 |
| Net Charge | 0 |
| Average Mass | 424.493 |
| Monoisotopic Mass | 424.18859 |
| SMILES | CC(C)=CCOc1c(C)cc(O)c2c1C(O)Oc1c(CC=C(C)C)ccc(O)c1C2=O |
| InChI | InChI=1S/C25H28O6/c1-13(2)6-7-16-8-9-17(26)20-22(28)19-18(27)12-15(5)23(30-11-10-14(3)4)21(19)25(29)31-24(16)20/h6,8-10,12,25-27,29H,7,11H2,1-5H3 |
| InChIKey | WKCOWVOAMWLTDQ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus (ncbitaxon:5052) | - | PubMed (22026385) |
| Roles Classification |
|---|
| Biological Roles: | Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| arugosin B (CHEBI:68859) has role Aspergillus metabolite (CHEBI:76956) |
| arugosin B (CHEBI:68859) has role antibacterial agent (CHEBI:33282) |
| arugosin B (CHEBI:68859) is a cyclic ketone (CHEBI:3992) |
| arugosin B (CHEBI:68859) is a dibenzooxepine (CHEBI:38926) |
| arugosin B (CHEBI:68859) is a lactol (CHEBI:38131) |
| arugosin B (CHEBI:68859) is a polyphenol (CHEBI:26195) |
| IUPAC Name |
|---|
| 1,6,10-trihydroxy-8-methyl-4-(3-methylbut-2-en-1-yl)-7-[(3-methylbut-2-en-1-yl)oxy]dibenzo[b,e]oxepin-11(6H)-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2025561 | Reaxys |
| Citations |
|---|